C16H20ClN3O — CID 117233203
1-[2-(5-chloro-4-phenoxypyrazol-1-yl)ethyl]piperidine (PubChem CID 117233203) has the molecular formula C16H20ClN3O and a molecular weight of 305.81 g/mol. Its IUPAC name is 1-[2-(5-chloro-4-phenoxypyrazol-1-yl)ethyl]piperidine.
| Compound Name | 1-[2-(5-chloro-4-phenoxypyrazol-1-yl)ethyl]piperidine |
|---|---|
| PubChem CID | 117233203 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-[2-(5-chloro-4-phenoxypyrazol-1-yl)ethyl]piperidine |
| SMILES | Clc1c(Oc2ccccc2)cnn1CCN1CCCCC1 |
| InChI | InChI=1S/C16H20ClN3O/c17-16-15(21-14-7-3-1-4-8-14)13-18-20(16)12-11-19-9-5-2-6-10-19/h1,3-4,7-8,13H,2,5-6,9-12H2 |
| InChIKey | VFZLIQNXIUSZJN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |