C15H15N3O3S — CID 11723348
5,7-dimethoxy-2-(pyridin-3-ylmethylamino)-1,3-benzothiazol-6-ol (PubChem CID 11723348) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 5,7-dimethoxy-2-(pyridin-3-ylmethylamino)-1,3-benzothiazol-6-ol.
| Compound Name | 5,7-dimethoxy-2-(pyridin-3-ylmethylamino)-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 11723348 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 5,7-dimethoxy-2-(pyridin-3-ylmethylamino)-1,3-benzothiazol-6-ol |
| SMILES | COc1cc2nc(NCc3cccnc3)sc2c(OC)c1O |
| InChI | InChI=1S/C15H15N3O3S/c1-20-11-6-10-14(13(21-2)12(11)19)22-15(18-10)17-8-9-4-3-5-16-7-9/h3-7,19H,8H2,1-2H3,(H,17,18) |
| InChIKey | AAFZJNQGJYIQOB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |