C13H20N2O3S — CID 117233939
2-[(1-cyclopentylpyrazol-4-yl)oxymethyl]thiolane 1,1-dioxide (PubChem CID 117233939) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 2-[(1-cyclopentylpyrazol-4-yl)oxymethyl]thiolane 1,1-dioxide.
| Compound Name | 2-[(1-cyclopentylpyrazol-4-yl)oxymethyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117233939 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2-[(1-cyclopentylpyrazol-4-yl)oxymethyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC1COc1cnn(C2CCCC2)c1 |
| InChI | InChI=1S/C13H20N2O3S/c16-19(17)7-3-6-13(19)10-18-12-8-14-15(9-12)11-4-1-2-5-11/h8-9,11,13H,1-7,10H2 |
| InChIKey | MCTFASTZPNGCIS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |