C8H12N2O3S — CID 117233453
2-(1H-pyrazol-4-yloxymethyl)thiolane 1,1-dioxide (PubChem CID 117233453) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-(1H-pyrazol-4-yloxymethyl)thiolane 1,1-dioxide.
| Compound Name | 2-(1H-pyrazol-4-yloxymethyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117233453 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(1H-pyrazol-4-yloxymethyl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC1COc1cn[nH]c1 |
| InChI | InChI=1S/C8H12N2O3S/c11-14(12)3-1-2-8(14)6-13-7-4-9-10-5-7/h4-5,8H,1-3,6H2,(H,9,10) |
| InChIKey | MBIRVEAUEVHGRA-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |