C11H21N3OS — CID 117235091
1-(azetidin-3-ylmethyl)-3-(thian-2-ylmethyl)urea (PubChem CID 117235091) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 1-(azetidin-3-ylmethyl)-3-(thian-2-ylmethyl)urea.
| Compound Name | 1-(azetidin-3-ylmethyl)-3-(thian-2-ylmethyl)urea |
|---|---|
| PubChem CID | 117235091 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 1-(azetidin-3-ylmethyl)-3-(thian-2-ylmethyl)urea |
| SMILES | O=C(NCC1CNC1)NCC1CCCCS1 |
| InChI | InChI=1S/C11H21N3OS/c15-11(13-7-9-5-12-6-9)14-8-10-3-1-2-4-16-10/h9-10,12H,1-8H2,(H2,13,14,15) |
| InChIKey | RISQGZUUDISBEQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |