C13H22N2O4S — CID 80612893
5-[(thian-2-ylmethylcarbamoylamino)methyl]oxolane-2-carboxylic acid (PubChem CID 80612893) has the molecular formula C13H22N2O4S and a molecular weight of 302.40 g/mol. Its IUPAC name is 5-[(thian-2-ylmethylcarbamoylamino)methyl]oxolane-2-carboxylic acid.
| Compound Name | 5-[(thian-2-ylmethylcarbamoylamino)methyl]oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 80612893 |
| Molecular Formula | C13H22N2O4S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 5-[(thian-2-ylmethylcarbamoylamino)methyl]oxolane-2-carboxylic acid |
| SMILES | O=C(NCC1CCC(C(=O)O)O1)NCC1CCCCS1 |
| InChI | InChI=1S/C13H22N2O4S/c16-12(17)11-5-4-9(19-11)7-14-13(18)15-8-10-3-1-2-6-20-10/h9-11H,1-8H2,(H,16,17)(H2,14,15,18) |
| InChIKey | MHAQUPIDCOKWEP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |