C12H19NO4S — CID 102945469
(2R,5S)-5-(thian-2-ylmethylcarbamoyl)oxolane-2-carboxylic acid (PubChem CID 102945469) has the molecular formula C12H19NO4S and a molecular weight of 273.35 g/mol. Its IUPAC name is (2R,5S)-5-(thian-2-ylmethylcarbamoyl)oxolane-2-carboxylic acid.
| Compound Name | (2R,5S)-5-(thian-2-ylmethylcarbamoyl)oxolane-2-carboxylic acid |
|---|---|
| PubChem CID | 102945469 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2R,5S)-5-(thian-2-ylmethylcarbamoyl)oxolane-2-carboxylic acid |
| SMILES | O=C(NCC1CCCCS1)[C@@H]1CC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C12H19NO4S/c14-11(9-4-5-10(17-9)12(15)16)13-7-8-3-1-2-6-18-8/h8-10H,1-7H2,(H,13,14)(H,15,16)/t8?,9-,10+/m0/s1 |
| InChIKey | OCEDSZAVBPMTLZ-CBMCFHRWSA-N |
| XLogP | 1.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |