C9H13N3O2 — CID 117235239
1-(furan-2-yl)-3-pyrrolidin-3-ylurea (PubChem CID 117235239) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-(furan-2-yl)-3-pyrrolidin-3-ylurea.
| Compound Name | 1-(furan-2-yl)-3-pyrrolidin-3-ylurea |
|---|---|
| PubChem CID | 117235239 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-(furan-2-yl)-3-pyrrolidin-3-ylurea |
| SMILES | O=C(Nc1ccco1)NC1CCNC1 |
| InChI | InChI=1S/C9H13N3O2/c13-9(11-7-3-4-10-6-7)12-8-2-1-5-14-8/h1-2,5,7,10H,3-4,6H2,(H2,11,12,13) |
| InChIKey | MHZRSXVDZLFAFG-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |