C14H21N3O — CID 117235751
1-(azepan-3-yl)-3-(2-methylphenyl)urea (PubChem CID 117235751) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(azepan-3-yl)-3-(2-methylphenyl)urea.
| Compound Name | 1-(azepan-3-yl)-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 117235751 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-(azepan-3-yl)-3-(2-methylphenyl)urea |
| SMILES | Cc1ccccc1NC(=O)NC1CCCCNC1 |
| InChI | InChI=1S/C14H21N3O/c1-11-6-2-3-8-13(11)17-14(18)16-12-7-4-5-9-15-10-12/h2-3,6,8,12,15H,4-5,7,9-10H2,1H3,(H2,16,17,18) |
| InChIKey | XIHCQNMSRFZBMU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |