C10H16N2O2 — CID 117236788
4-methoxy-1-pyridin-3-yloxybutan-2-amine (PubChem CID 117236788) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-methoxy-1-pyridin-3-yloxybutan-2-amine.
| Compound Name | 4-methoxy-1-pyridin-3-yloxybutan-2-amine |
|---|---|
| PubChem CID | 117236788 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 4-methoxy-1-pyridin-3-yloxybutan-2-amine |
| SMILES | COCCC(N)COc1cccnc1 |
| InChI | InChI=1S/C10H16N2O2/c1-13-6-4-9(11)8-14-10-3-2-5-12-7-10/h2-3,5,7,9H,4,6,8,11H2,1H3 |
| InChIKey | PAFVZSKYOIPJPM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |