C11H18N2O — CID 117241997
2-(pyridin-3-yloxymethyl)pentan-1-amine (PubChem CID 117241997) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(pyridin-3-yloxymethyl)pentan-1-amine.
| Compound Name | 2-(pyridin-3-yloxymethyl)pentan-1-amine |
|---|---|
| PubChem CID | 117241997 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(pyridin-3-yloxymethyl)pentan-1-amine |
| SMILES | CCCC(CN)COc1cccnc1 |
| InChI | InChI=1S/C11H18N2O/c1-2-4-10(7-12)9-14-11-5-3-6-13-8-11/h3,5-6,8,10H,2,4,7,9,12H2,1H3 |
| InChIKey | FNHVFQZYHAJYRN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |