C16H22F3NO2 — CID 117239219
2-(1-methylpiperidin-4-yl)-3-[2-(trifluoromethyl)phenoxy]propan-1-ol (PubChem CID 117239219) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-(1-methylpiperidin-4-yl)-3-[2-(trifluoromethyl)phenoxy]propan-1-ol.
| Compound Name | 2-(1-methylpiperidin-4-yl)-3-[2-(trifluoromethyl)phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 117239219 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 2-(1-methylpiperidin-4-yl)-3-[2-(trifluoromethyl)phenoxy]propan-1-ol |
| SMILES | CN1CCC(C(CO)COc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H22F3NO2/c1-20-8-6-12(7-9-20)13(10-21)11-22-15-5-3-2-4-14(15)16(17,18)19/h2-5,12-13,21H,6-11H2,1H3 |
| InChIKey | TXPLLNLKYMWVBN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |