C13H17F3O3 — CID 63628931
1-(2,2-diethoxyethoxy)-2-(trifluoromethyl)benzene (PubChem CID 63628931) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxy)-2-(trifluoromethyl)benzene.
| Compound Name | 1-(2,2-diethoxyethoxy)-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 63628931 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-(2,2-diethoxyethoxy)-2-(trifluoromethyl)benzene |
| SMILES | CCOC(COc1ccccc1C(F)(F)F)OCC |
| InChI | InChI=1S/C13H17F3O3/c1-3-17-12(18-4-2)9-19-11-8-6-5-7-10(11)13(14,15)16/h5-8,12H,3-4,9H2,1-2H3 |
| InChIKey | BIPAILBNTFVKBQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|