C16H21F3O3 — CID 166929604
2-(2,2-diethoxyethoxy)-4-[(E)-prop-1-enyl]-1-(trifluoromethyl)benzene (PubChem CID 166929604) has the molecular formula C16H21F3O3 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-(2,2-diethoxyethoxy)-4-[(E)-prop-1-enyl]-1-(trifluoromethyl)benzene.
| Compound Name | 2-(2,2-diethoxyethoxy)-4-[(E)-prop-1-enyl]-1-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 166929604 |
| Molecular Formula | C16H21F3O3 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 2-(2,2-diethoxyethoxy)-4-[(E)-prop-1-enyl]-1-(trifluoromethyl)benzene |
| SMILES | C/C=C/c1ccc(C(F)(F)F)c(OCC(OCC)OCC)c1 |
| InChI | InChI=1S/C16H21F3O3/c1-4-7-12-8-9-13(16(17,18)19)14(10-12)22-11-15(20-5-2)21-6-3/h4,7-10,15H,5-6,11H2,1-3H3/b7-4+ |
| InChIKey | RJNSMXRSRATZEP-QPJJXVBHSA-N |
| XLogP | 4.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|