C16H26O3 — CID 13416777
1-tert-butyl-2-(2,2-diethoxyethoxy)benzene (PubChem CID 13416777) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 1-tert-butyl-2-(2,2-diethoxyethoxy)benzene.
| Compound Name | 1-tert-butyl-2-(2,2-diethoxyethoxy)benzene |
|---|---|
| PubChem CID | 13416777 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 1-tert-butyl-2-(2,2-diethoxyethoxy)benzene |
| SMILES | CCOC(COc1ccccc1C(C)(C)C)OCC |
| InChI | InChI=1S/C16H26O3/c1-6-17-15(18-7-2)12-19-14-11-9-8-10-13(14)16(3,4)5/h8-11,15H,6-7,12H2,1-5H3 |
| InChIKey | YOLBHPCHKMIZHW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|