C14H20F3NO — CID 117241683
4,4-dimethyl-1-[2-(trifluoromethyl)phenoxy]pentan-2-amine (PubChem CID 117241683) has the molecular formula C14H20F3NO and a molecular weight of 275.31 g/mol. Its IUPAC name is 4,4-dimethyl-1-[2-(trifluoromethyl)phenoxy]pentan-2-amine.
| Compound Name | 4,4-dimethyl-1-[2-(trifluoromethyl)phenoxy]pentan-2-amine |
|---|---|
| PubChem CID | 117241683 |
| Molecular Formula | C14H20F3NO |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 4,4-dimethyl-1-[2-(trifluoromethyl)phenoxy]pentan-2-amine |
| SMILES | CC(C)(C)CC(N)COc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO/c1-13(2,3)8-10(18)9-19-12-7-5-4-6-11(12)14(15,16)17/h4-7,10H,8-9,18H2,1-3H3 |
| InChIKey | OOICOUKGJPRTTE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |