C20H25NO3 — CID 11723972
tert-butyl 4-[3-(2-cyano-3-oxocyclopentyl)propyl]benzoate (PubChem CID 11723972) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is tert-butyl 4-[3-(2-cyano-3-oxocyclopentyl)propyl]benzoate.
| Compound Name | tert-butyl 4-[3-(2-cyano-3-oxocyclopentyl)propyl]benzoate |
|---|---|
| PubChem CID | 11723972 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | tert-butyl 4-[3-(2-cyano-3-oxocyclopentyl)propyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1ccc(CCCC2CCC(=O)C2C#N)cc1 |
| InChI | InChI=1S/C20H25NO3/c1-20(2,3)24-19(23)16-9-7-14(8-10-16)5-4-6-15-11-12-18(22)17(15)13-21/h7-10,15,17H,4-6,11-12H2,1-3H3 |
| InChIKey | ZLYFEYYIJLNDEF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |