C16H15F3O3 — CID 117242621
2-(2-methoxyphenoxy)-1-[3-(trifluoromethyl)phenyl]ethanol (PubChem CID 117242621) has the molecular formula C16H15F3O3 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-(2-methoxyphenoxy)-1-[3-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-(2-methoxyphenoxy)-1-[3-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 117242621 |
| Molecular Formula | C16H15F3O3 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 2-(2-methoxyphenoxy)-1-[3-(trifluoromethyl)phenyl]ethanol |
| SMILES | COc1ccccc1OCC(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H15F3O3/c1-21-14-7-2-3-8-15(14)22-10-13(20)11-5-4-6-12(9-11)16(17,18)19/h2-9,13,20H,10H2,1H3 |
| InChIKey | FQWQGLJJFBFPOP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |