C15H18F3NO2 — CID 117243206
methyl 3-(cyclobutylamino)-2-[3-(trifluoromethyl)phenyl]propanoate (PubChem CID 117243206) has the molecular formula C15H18F3NO2 and a molecular weight of 301.31 g/mol. Its IUPAC name is methyl 3-(cyclobutylamino)-2-[3-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl 3-(cyclobutylamino)-2-[3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 117243206 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl 3-(cyclobutylamino)-2-[3-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)C(CNC1CCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H18F3NO2/c1-21-14(20)13(9-19-12-6-3-7-12)10-4-2-5-11(8-10)15(16,17)18/h2,4-5,8,12-13,19H,3,6-7,9H2,1H3 |
| InChIKey | ARZSTJSMIHUJRG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |