C14H17F3IO3P — CID 139503955
methyl 6-iodophosphanyloxy-2-[3-(trifluoromethyl)phenyl]hexanoate (PubChem CID 139503955) has the molecular formula C14H17F3IO3P and a molecular weight of 448.16 g/mol. Its IUPAC name is methyl 6-iodophosphanyloxy-2-[3-(trifluoromethyl)phenyl]hexanoate.
| Compound Name | methyl 6-iodophosphanyloxy-2-[3-(trifluoromethyl)phenyl]hexanoate |
|---|---|
| PubChem CID | 139503955 |
| Molecular Formula | C14H17F3IO3P |
| Molecular Weight | 448.16 g/mol |
| Exact Mass | 447.99 |
| IUPAC Name | methyl 6-iodophosphanyloxy-2-[3-(trifluoromethyl)phenyl]hexanoate |
| SMILES | COC(=O)C(CCCCOPI)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3IO3P/c1-20-13(19)12(7-2-3-8-21-22-18)10-5-4-6-11(9-10)14(15,16)17/h4-6,9,12,22H,2-3,7-8H2,1H3 |
| InChIKey | HFHRYPPXZMIMSF-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.16 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|