C16H21IO3 — CID 174253201
methyl 2-(3-iodophenyl)-6,6-dimethyl-7-oxoheptanoate (PubChem CID 174253201) has the molecular formula C16H21IO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is methyl 2-(3-iodophenyl)-6,6-dimethyl-7-oxoheptanoate.
| Compound Name | methyl 2-(3-iodophenyl)-6,6-dimethyl-7-oxoheptanoate |
|---|---|
| PubChem CID | 174253201 |
| Molecular Formula | C16H21IO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | methyl 2-(3-iodophenyl)-6,6-dimethyl-7-oxoheptanoate |
| SMILES | COC(=O)C(CCCC(C)(C)C=O)c1cccc(I)c1 |
| InChI | InChI=1S/C16H21IO3/c1-16(2,11-18)9-5-8-14(15(19)20-3)12-6-4-7-13(17)10-12/h4,6-7,10-11,14H,5,8-9H2,1-3H3 |
| InChIKey | ZGLNLEXGUMKJRG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|