C13H14F2IN3O2 — CID 171078000
methyl 6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoate (PubChem CID 171078000) has the molecular formula C13H14F2IN3O2 and a molecular weight of 409.17 g/mol. Its IUPAC name is methyl 6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoate.
| Compound Name | methyl 6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoate |
|---|---|
| PubChem CID | 171078000 |
| Molecular Formula | C13H14F2IN3O2 |
| Molecular Weight | 409.17 g/mol |
| Exact Mass | 409.01 |
| IUPAC Name | methyl 6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoate |
| SMILES | COC(=O)C(CCC(F)(F)CN=[N+]=[N-])c1cccc(I)c1 |
| InChI | InChI=1S/C13H14F2IN3O2/c1-21-12(20)11(9-3-2-4-10(16)7-9)5-6-13(14,15)8-18-19-17/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | IRJGNPSPQSICNM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.17 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|