C12H12F2IN3O2 — CID 174252170
6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoic acid (PubChem CID 174252170) has the molecular formula C12H12F2IN3O2 and a molecular weight of 395.15 g/mol. Its IUPAC name is 6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoic acid.
| Compound Name | 6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoic acid |
|---|---|
| PubChem CID | 174252170 |
| Molecular Formula | C12H12F2IN3O2 |
| Molecular Weight | 395.15 g/mol |
| Exact Mass | 394.99 |
| IUPAC Name | 6-azido-5,5-difluoro-2-(3-iodophenyl)hexanoic acid |
| SMILES | [N-]=[N+]=NCC(F)(F)CCC(C(=O)O)c1cccc(I)c1 |
| InChI | InChI=1S/C12H12F2IN3O2/c13-12(14,7-17-18-16)5-4-10(11(19)20)8-2-1-3-9(15)6-8/h1-3,6,10H,4-5,7H2,(H,19,20) |
| InChIKey | SAVZKXKRVWLWJP-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.15 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|