C10H11FN4O2 — CID 66190399
2-(2-azidoethylamino)-2-(3-fluorophenyl)acetic acid (PubChem CID 66190399) has the molecular formula C10H11FN4O2 and a molecular weight of 238.22 g/mol. Its IUPAC name is 2-(2-azidoethylamino)-2-(3-fluorophenyl)acetic acid.
| Compound Name | 2-(2-azidoethylamino)-2-(3-fluorophenyl)acetic acid |
|---|---|
| PubChem CID | 66190399 |
| Molecular Formula | C10H11FN4O2 |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-(2-azidoethylamino)-2-(3-fluorophenyl)acetic acid |
| SMILES | [N-]=[N+]=NCCNC(C(=O)O)c1cccc(F)c1 |
| InChI | InChI=1S/C10H11FN4O2/c11-8-3-1-2-7(6-8)9(10(16)17)13-4-5-14-15-12/h1-3,6,9,13H,4-5H2,(H,16,17) |
| InChIKey | FTAJRXZSOHBOFB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|