C11H14N4O3 — CID 66189497
2-(3-azidopropylamino)-2-(4-hydroxyphenyl)acetic acid (PubChem CID 66189497) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(4-hydroxyphenyl)acetic acid.
| Compound Name | 2-(3-azidopropylamino)-2-(4-hydroxyphenyl)acetic acid |
|---|---|
| PubChem CID | 66189497 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(4-hydroxyphenyl)acetic acid |
| SMILES | [N-]=[N+]=NCCCNC(C(=O)O)c1ccc(O)cc1 |
| InChI | InChI=1S/C11H14N4O3/c12-15-14-7-1-6-13-10(11(17)18)8-2-4-9(16)5-3-8/h2-5,10,13,16H,1,6-7H2,(H,17,18) |
| InChIKey | YUWKCHCLCSCJLX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|