C15H23N5O — CID 66165567
2-(3-azidopropylamino)-2-(4-tert-butylphenyl)acetamide (PubChem CID 66165567) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(4-tert-butylphenyl)acetamide.
| Compound Name | 2-(3-azidopropylamino)-2-(4-tert-butylphenyl)acetamide |
|---|---|
| PubChem CID | 66165567 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(4-tert-butylphenyl)acetamide |
| SMILES | CC(C)(C)c1ccc(C(NCCCN=[N+]=[N-])C(N)=O)cc1 |
| InChI | InChI=1S/C15H23N5O/c1-15(2,3)12-7-5-11(6-8-12)13(14(16)21)18-9-4-10-19-20-17/h5-8,13,18H,4,9-10H2,1-3H3,(H2,16,21) |
| InChIKey | NUDBOLUGIIOYIW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|