C11H13F2N5O — CID 66164945
2-(3-azidopropylamino)-2-(2,6-difluorophenyl)acetamide (PubChem CID 66164945) has the molecular formula C11H13F2N5O and a molecular weight of 269.25 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-(2,6-difluorophenyl)acetamide.
| Compound Name | 2-(3-azidopropylamino)-2-(2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 66164945 |
| Molecular Formula | C11H13F2N5O |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 2-(3-azidopropylamino)-2-(2,6-difluorophenyl)acetamide |
| SMILES | [N-]=[N+]=NCCCNC(C(N)=O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H13F2N5O/c12-7-3-1-4-8(13)9(7)10(11(14)19)16-5-2-6-17-18-15/h1,3-4,10,16H,2,5-6H2,(H2,14,19) |
| InChIKey | JWSNZCBOEWKTAJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 103.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|