C13H19N5O2 — CID 66188947
2-(3-azidopropylamino)-2-[2-(methoxymethyl)phenyl]acetamide (PubChem CID 66188947) has the molecular formula C13H19N5O2 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-(3-azidopropylamino)-2-[2-(methoxymethyl)phenyl]acetamide.
| Compound Name | 2-(3-azidopropylamino)-2-[2-(methoxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 66188947 |
| Molecular Formula | C13H19N5O2 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 2-(3-azidopropylamino)-2-[2-(methoxymethyl)phenyl]acetamide |
| SMILES | COCc1ccccc1C(NCCCN=[N+]=[N-])C(N)=O |
| InChI | InChI=1S/C13H19N5O2/c1-20-9-10-5-2-3-6-11(10)12(13(14)19)16-7-4-8-17-18-15/h2-3,5-6,12,16H,4,7-9H2,1H3,(H2,14,19) |
| InChIKey | HCUUCWBLBRHYTK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 113.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|