C13H13BrF2IN3O — CID 174250860
7-azido-1-bromo-6,6-difluoro-3-(3-iodophenyl)heptan-2-one (PubChem CID 174250860) has the molecular formula C13H13BrF2IN3O and a molecular weight of 472.07 g/mol. Its IUPAC name is 7-azido-1-bromo-6,6-difluoro-3-(3-iodophenyl)heptan-2-one.
| Compound Name | 7-azido-1-bromo-6,6-difluoro-3-(3-iodophenyl)heptan-2-one |
|---|---|
| PubChem CID | 174250860 |
| Molecular Formula | C13H13BrF2IN3O |
| Molecular Weight | 472.07 g/mol |
| Exact Mass | 470.93 |
| IUPAC Name | 7-azido-1-bromo-6,6-difluoro-3-(3-iodophenyl)heptan-2-one |
| SMILES | [N-]=[N+]=NCC(F)(F)CCC(C(=O)CBr)c1cccc(I)c1 |
| InChI | InChI=1S/C13H13BrF2IN3O/c14-7-12(21)11(9-2-1-3-10(17)6-9)4-5-13(15,16)8-19-20-18/h1-3,6,11H,4-5,7-8H2 |
| InChIKey | ZEKLNVQIGJGJHG-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 65.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.07 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|