C18H25N3O — CID 11724529
N-(2-cyclopent-2-en-1-yl-6-methylphenyl)-2-piperazin-1-ylacetamide (PubChem CID 11724529) has the molecular formula C18H25N3O and a molecular weight of 299.42 g/mol. Its IUPAC name is N-(2-cyclopent-2-en-1-yl-6-methylphenyl)-2-piperazin-1-ylacetamide.
| Compound Name | N-(2-cyclopent-2-en-1-yl-6-methylphenyl)-2-piperazin-1-ylacetamide |
|---|---|
| PubChem CID | 11724529 |
| Molecular Formula | C18H25N3O |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | N-(2-cyclopent-2-en-1-yl-6-methylphenyl)-2-piperazin-1-ylacetamide |
| SMILES | Cc1cccc(C2C=CCC2)c1NC(=O)CN1CCNCC1 |
| InChI | InChI=1S/C18H25N3O/c1-14-5-4-8-16(15-6-2-3-7-15)18(14)20-17(22)13-21-11-9-19-10-12-21/h2,4-6,8,15,19H,3,7,9-13H2,1H3,(H,20,22) |
| InChIKey | NXSCRJAAGFQDIG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|