C14H13ClO4 — CID 117246393
2-[(3-chlorophenoxy)methyl]-3-(furan-2-yl)propanoic acid (PubChem CID 117246393) has the molecular formula C14H13ClO4 and a molecular weight of 280.71 g/mol. Its IUPAC name is 2-[(3-chlorophenoxy)methyl]-3-(furan-2-yl)propanoic acid.
| Compound Name | 2-[(3-chlorophenoxy)methyl]-3-(furan-2-yl)propanoic acid |
|---|---|
| PubChem CID | 117246393 |
| Molecular Formula | C14H13ClO4 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-[(3-chlorophenoxy)methyl]-3-(furan-2-yl)propanoic acid |
| SMILES | O=C(O)C(COc1cccc(Cl)c1)Cc1ccco1 |
| InChI | InChI=1S/C14H13ClO4/c15-11-3-1-4-13(8-11)19-9-10(14(16)17)7-12-5-2-6-18-12/h1-6,8,10H,7,9H2,(H,16,17) |
| InChIKey | UCZHTZZUZVQOFT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |