C9H9ClN2S — CID 117247100
(3-chloro-7-methylimidazo[1,5-a]pyridin-1-yl)methanethiol (PubChem CID 117247100) has the molecular formula C9H9ClN2S and a molecular weight of 212.71 g/mol. Its IUPAC name is (3-chloro-7-methylimidazo[1,5-a]pyridin-1-yl)methanethiol.
| Compound Name | (3-chloro-7-methylimidazo[1,5-a]pyridin-1-yl)methanethiol |
|---|---|
| PubChem CID | 117247100 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | (3-chloro-7-methylimidazo[1,5-a]pyridin-1-yl)methanethiol |
| SMILES | Cc1ccn2c(Cl)nc(CS)c2c1 |
| InChI | InChI=1S/C9H9ClN2S/c1-6-2-3-12-8(4-6)7(5-13)11-9(12)10/h2-4,13H,5H2,1H3 |
| InChIKey | VMQXLEQRKJUSLL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 17.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|