About 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol
1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol (PubChem CID 117247809) has the molecular formula C7H9BrN2O
and a molecular weight of 217.07 g/mol. Its IUPAC name is 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol.
Analyze 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol?
The IUPAC name of 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol (CID 117247809) is 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol.
What is the SMILES notation for 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol?
The canonical SMILES for 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol is OC1CCCc2c(Br)ncn21.
What is the InChIKey of 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol?
The InChIKey is HPNNUHPUNNQERA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN2O/c8-7-5-2-1-3-6(11)10(5)4-9-7/h4,6,11H,1-3H2.
What are the key properties of 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol?
1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol has a molecular weight of 217.07 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-5-ol is sourced from PubChem (CID 117247809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).