C21H26O4 — CID 11724949
(3Z,3aR,4R,6aR)-3-benzylidene-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione (PubChem CID 11724949) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is (3Z,3aR,4R,6aR)-3-benzylidene-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione.
| Compound Name | (3Z,3aR,4R,6aR)-3-benzylidene-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
|---|---|
| PubChem CID | 11724949 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (3Z,3aR,4R,6aR)-3-benzylidene-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
| SMILES | CCCCCCCC[C@H]1OC(=O)[C@@H]2OC(=O)/C(=C\c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C21H26O4/c1-2-3-4-5-6-10-13-17-18-16(14-15-11-8-7-9-12-15)20(22)25-19(18)21(23)24-17/h7-9,11-12,14,17-19H,2-6,10,13H2,1H3/b16-14-/t17-,18-,19-/m1/s1 |
| InChIKey | HELDLPQLOPSWBP-JYNJHCBESA-N |
| XLogP | 4.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|