C14H14O5 — CID 15667489
[(3aR,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methyl benzoate (PubChem CID 15667489) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is [(3aR,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methyl benzoate.
| Compound Name | [(3aR,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 15667489 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [(3aR,4S,6aR)-2-oxo-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]furan-4-yl]methyl benzoate |
| SMILES | O=C1C[C@H]2[C@H](CO[C@@H]2COC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C14H14O5/c15-13-6-10-11(17-8-12(10)19-13)7-18-14(16)9-4-2-1-3-5-9/h1-5,10-12H,6-8H2/t10-,11-,12+/m1/s1 |
| InChIKey | NIRQJZCDIDRTLO-UTUOFQBUSA-N |
| XLogP | 1.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |