C17H19NO5 — CID 10425947
[(3aR,4S,6aR)-2-oxo-5-prop-2-enoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]methyl benzoate (PubChem CID 10425947) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is [(3aR,4S,6aR)-2-oxo-5-prop-2-enoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]methyl benzoate.
| Compound Name | [(3aR,4S,6aR)-2-oxo-5-prop-2-enoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 10425947 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [(3aR,4S,6aR)-2-oxo-5-prop-2-enoxy-3a,4,6,6a-tetrahydro-3H-furo[2,3-c]pyrrol-4-yl]methyl benzoate |
| SMILES | C=CCON1C[C@@H]2OC(=O)C[C@@H]2[C@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO5/c1-2-8-22-18-10-15-13(9-16(19)23-15)14(18)11-21-17(20)12-6-4-3-5-7-12/h2-7,13-15H,1,8-11H2/t13-,14-,15+/m1/s1 |
| InChIKey | GMKXKGCGEUNJOE-KFWWJZLASA-N |
| XLogP | 1.58 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|