C29H24O9 — CID 51051387
[(3aR,4R,5R,6R,7aR)-4,5-dibenzoyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl benzoate (PubChem CID 51051387) has the molecular formula C29H24O9 and a molecular weight of 516.50 g/mol. Its IUPAC name is [(3aR,4R,5R,6R,7aR)-4,5-dibenzoyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl benzoate.
| Compound Name | [(3aR,4R,5R,6R,7aR)-4,5-dibenzoyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 51051387 |
| Molecular Formula | C29H24O9 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.14 |
| IUPAC Name | [(3aR,4R,5R,6R,7aR)-4,5-dibenzoyloxy-2-oxo-3,3a,4,5,6,7a-hexahydrofuro[2,3-b]pyran-6-yl]methyl benzoate |
| SMILES | O=C1C[C@H]2[C@@H](O1)O[C@H](COC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H24O9/c30-23-16-21-24(37-27(32)19-12-6-2-7-13-19)25(38-28(33)20-14-8-3-9-15-20)22(35-29(21)36-23)17-34-26(31)18-10-4-1-5-11-18/h1-15,21-22,24-25,29H,16-17H2/t21-,22-,24-,25+,29-/m1/s1 |
| InChIKey | FXFFISDCOBHUEF-OFXBGWBLSA-N |
| XLogP | 3.58 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|