C13H9ClFN3 — CID 117251378
1-chloro-3-(2-fluorophenyl)imidazo[1,5-a]pyridin-6-amine (PubChem CID 117251378) has the molecular formula C13H9ClFN3 and a molecular weight of 261.69 g/mol. Its IUPAC name is 1-chloro-3-(2-fluorophenyl)imidazo[1,5-a]pyridin-6-amine.
| Compound Name | 1-chloro-3-(2-fluorophenyl)imidazo[1,5-a]pyridin-6-amine |
|---|---|
| PubChem CID | 117251378 |
| Molecular Formula | C13H9ClFN3 |
| Molecular Weight | 261.69 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 1-chloro-3-(2-fluorophenyl)imidazo[1,5-a]pyridin-6-amine |
| SMILES | Nc1ccc2c(Cl)nc(-c3ccccc3F)n2c1 |
| InChI | InChI=1S/C13H9ClFN3/c14-12-11-6-5-8(16)7-18(11)13(17-12)9-3-1-2-4-10(9)15/h1-7H,16H2 |
| InChIKey | JAGVOHSCOKBWRT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |