About 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid
3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid (PubChem CID 117251777) has the molecular formula C14H9N3O4
and a molecular weight of 283.24 g/mol. Its IUPAC name is 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid |
| PubChem CID | 117251777 |
| Molecular Formula | C14H9N3O4 |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid |
| SMILES | O=C(O)c1ccn2c(-c3cccnc3)nc(C(=O)O)c2c1 |
| InChI | InChI=1S/C14H9N3O4/c18-13(19)8-3-5-17-10(6-8)11(14(20)21)16-12(17)9-2-1-4-15-7-9/h1-7H,(H,18,19)(H,20,21) |
| InChIKey | COFVXILOEONEKW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid?
The IUPAC name of 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid (CID 117251777) is 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid.
What is the SMILES notation for 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid?
The canonical SMILES for 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid is O=C(O)c1ccn2c(-c3cccnc3)nc(C(=O)O)c2c1.
What is the InChIKey of 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid?
The InChIKey is COFVXILOEONEKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9N3O4/c18-13(19)8-3-5-17-10(6-8)11(14(20)21)16-12(17)9-2-1-4-15-7-9/h1-7H,(H,18,19)(H,20,21).
What are the key properties of 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid?
3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid has a molecular weight of 283.24 g/mol, XLogP of 1.79, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-3-ylimidazo[1,5-a]pyridine-1,7-dicarboxylic acid is sourced from PubChem (CID 117251777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).