C18H18ClNO4 — CID 11725288
6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxane-4-carboxamide (PubChem CID 11725288) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxane-4-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxane-4-carboxamide |
|---|---|
| PubChem CID | 11725288 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 6-(4-chlorophenyl)-3-hydroxy-3-methyl-6-phenyldioxane-4-carboxamide |
| SMILES | CC1(O)OOC(c2ccccc2)(c2ccc(Cl)cc2)CC1C(N)=O |
| InChI | InChI=1S/C18H18ClNO4/c1-17(22)15(16(20)21)11-18(24-23-17,12-5-3-2-4-6-12)13-7-9-14(19)10-8-13/h2-10,15,22H,11H2,1H3,(H2,20,21) |
| InChIKey | ZKDFKSYJBWQDTD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|