C11H10N2O4 — CID 117253439
methyl 6-hydroxy-3-(2-oxoethyl)imidazo[1,5-a]pyridine-1-carboxylate (PubChem CID 117253439) has the molecular formula C11H10N2O4 and a molecular weight of 234.21 g/mol. Its IUPAC name is methyl 6-hydroxy-3-(2-oxoethyl)imidazo[1,5-a]pyridine-1-carboxylate.
| Compound Name | methyl 6-hydroxy-3-(2-oxoethyl)imidazo[1,5-a]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 117253439 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | methyl 6-hydroxy-3-(2-oxoethyl)imidazo[1,5-a]pyridine-1-carboxylate |
| SMILES | COC(=O)c1nc(CC=O)n2cc(O)ccc12 |
| InChI | InChI=1S/C11H10N2O4/c1-17-11(16)10-8-3-2-7(15)6-13(8)9(12-10)4-5-14/h2-3,5-6,15H,4H2,1H3 |
| InChIKey | RKRZSAWJHWUJKF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|