C14H19N3O2 — CID 117253873
methyl 6-methyl-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylate (PubChem CID 117253873) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is methyl 6-methyl-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylate.
| Compound Name | methyl 6-methyl-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 117253873 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | methyl 6-methyl-3-[3-(methylamino)propyl]imidazo[1,5-a]pyridine-1-carboxylate |
| SMILES | CNCCCc1nc(C(=O)OC)c2ccc(C)cn12 |
| InChI | InChI=1S/C14H19N3O2/c1-10-6-7-11-13(14(18)19-3)16-12(17(11)9-10)5-4-8-15-2/h6-7,9,15H,4-5,8H2,1-3H3 |
| InChIKey | UOGGEPZWKPLQDH-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|