C11H13BrClN3 — CID 117253851
3-(1-bromo-6-chloroimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-1-amine (PubChem CID 117253851) has the molecular formula C11H13BrClN3 and a molecular weight of 302.60 g/mol. Its IUPAC name is 3-(1-bromo-6-chloroimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-1-amine.
| Compound Name | 3-(1-bromo-6-chloroimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 117253851 |
| Molecular Formula | C11H13BrClN3 |
| Molecular Weight | 302.60 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 3-(1-bromo-6-chloroimidazo[1,5-a]pyridin-3-yl)-N-methylpropan-1-amine |
| SMILES | CNCCCc1nc(Br)c2ccc(Cl)cn12 |
| InChI | InChI=1S/C11H13BrClN3/c1-14-6-2-3-10-15-11(12)9-5-4-8(13)7-16(9)10/h4-5,7,14H,2-3,6H2,1H3 |
| InChIKey | UBTACJIVRVIKTO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.60 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|