C9H9Br2N3 — CID 84744625
2-(1,6-dibromoimidazo[1,5-a]pyridin-3-yl)ethanamine (PubChem CID 84744625) has the molecular formula C9H9Br2N3 and a molecular weight of 319.00 g/mol. Its IUPAC name is 2-(1,6-dibromoimidazo[1,5-a]pyridin-3-yl)ethanamine.
| Compound Name | 2-(1,6-dibromoimidazo[1,5-a]pyridin-3-yl)ethanamine |
|---|---|
| PubChem CID | 84744625 |
| Molecular Formula | C9H9Br2N3 |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 316.92 |
| IUPAC Name | 2-(1,6-dibromoimidazo[1,5-a]pyridin-3-yl)ethanamine |
| SMILES | NCCc1nc(Br)c2ccc(Br)cn12 |
| InChI | InChI=1S/C9H9Br2N3/c10-6-1-2-7-9(11)13-8(3-4-12)14(7)5-6/h1-2,5H,3-4,12H2 |
| InChIKey | ZPBOSJLCJLRZLO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |