C10H9BrN2O2 — CID 117253977
2-(1-bromo-7-methoxyimidazo[1,5-a]pyridin-3-yl)acetaldehyde (PubChem CID 117253977) has the molecular formula C10H9BrN2O2 and a molecular weight of 269.10 g/mol. Its IUPAC name is 2-(1-bromo-7-methoxyimidazo[1,5-a]pyridin-3-yl)acetaldehyde.
| Compound Name | 2-(1-bromo-7-methoxyimidazo[1,5-a]pyridin-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 117253977 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 2-(1-bromo-7-methoxyimidazo[1,5-a]pyridin-3-yl)acetaldehyde |
| SMILES | COc1ccn2c(CC=O)nc(Br)c2c1 |
| InChI | InChI=1S/C10H9BrN2O2/c1-15-7-2-4-13-8(6-7)10(11)12-9(13)3-5-14/h2,4-6H,3H2,1H3 |
| InChIKey | GWNFPQDXLWCLDA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|