C15H19ClN6O2 — CID 11725470
2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-1,1-dimethylguanidine (PubChem CID 11725470) has the molecular formula C15H19ClN6O2 and a molecular weight of 350.81 g/mol. Its IUPAC name is 2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-1,1-dimethylguanidine.
| Compound Name | 2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 11725470 |
| Molecular Formula | C15H19ClN6O2 |
| Molecular Weight | 350.81 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-(4-amino-1,3-dimethyl-2,6-dioxopyrimidin-5-yl)-3-(3-chlorophenyl)-1,1-dimethylguanidine |
| SMILES | CN(C)/C(=N/c1c(N)n(C)c(=O)n(C)c1=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H19ClN6O2/c1-20(2)14(18-10-7-5-6-9(16)8-10)19-11-12(17)21(3)15(24)22(4)13(11)23/h5-8H,17H2,1-4H3,(H,18,19) |
| InChIKey | KGQINANVVCWXGH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.81 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|