C13H9Cl2N3O — CID 117257005
5-chloro-3-[(3-chlorophenoxy)methyl]-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117257005) has the molecular formula C13H9Cl2N3O and a molecular weight of 294.14 g/mol. Its IUPAC name is 5-chloro-3-[(3-chlorophenoxy)methyl]-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 5-chloro-3-[(3-chlorophenoxy)methyl]-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117257005 |
| Molecular Formula | C13H9Cl2N3O |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 293.01 |
| IUPAC Name | 5-chloro-3-[(3-chlorophenoxy)methyl]-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Clc1cccc(OCc2nnc3cccc(Cl)n23)c1 |
| InChI | InChI=1S/C13H9Cl2N3O/c14-9-3-1-4-10(7-9)19-8-13-17-16-12-6-2-5-11(15)18(12)13/h1-7H,8H2 |
| InChIKey | MBBYTSHMFFUPHL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|