C7H6ClN3S — CID 117257045
(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol (PubChem CID 117257045) has the molecular formula C7H6ClN3S and a molecular weight of 199.67 g/mol. Its IUPAC name is (5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol.
| Compound Name | (5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol |
|---|---|
| PubChem CID | 117257045 |
| Molecular Formula | C7H6ClN3S |
| Molecular Weight | 199.67 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | (5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)methanethiol |
| SMILES | SCc1nnc2cccc(Cl)n12 |
| InChI | InChI=1S/C7H6ClN3S/c8-5-2-1-3-6-9-10-7(4-12)11(5)6/h1-3,12H,4H2 |
| InChIKey | HBAPOTJEKFMGRT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 30.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.67 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|