C7H5Cl2N3 — CID 130018287
2,5-dichloroimidazo[1,2-a]pyridin-3-amine (PubChem CID 130018287) has the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. Its IUPAC name is 2,5-dichloroimidazo[1,2-a]pyridin-3-amine.
| Compound Name | 2,5-dichloroimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 130018287 |
| Molecular Formula | C7H5Cl2N3 |
| Molecular Weight | 202.04 g/mol |
| Exact Mass | 200.99 |
| IUPAC Name | 2,5-dichloroimidazo[1,2-a]pyridin-3-amine |
| SMILES | Nc1c(Cl)nc2cccc(Cl)n12 |
| InChI | InChI=1S/C7H5Cl2N3/c8-4-2-1-3-5-11-6(9)7(10)12(4)5/h1-3H,10H2 |
| InChIKey | IPEMGBILQJDQHQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.04 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|