C14H11ClN4 — CID 82343022
3-[(Z)-2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethenyl]aniline (PubChem CID 82343022) has the molecular formula C14H11ClN4 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-[(Z)-2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethenyl]aniline.
| Compound Name | 3-[(Z)-2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 82343022 |
| Molecular Formula | C14H11ClN4 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 3-[(Z)-2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethenyl]aniline |
| SMILES | Nc1cccc(/C=C\c2nnc3cccc(Cl)n23)c1 |
| InChI | InChI=1S/C14H11ClN4/c15-12-5-2-6-13-17-18-14(19(12)13)8-7-10-3-1-4-11(16)9-10/h1-9H,16H2/b8-7- |
| InChIKey | JDHAZVDFAMUPPV-FPLPWBNLSA-N |
| XLogP | 3.14 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|